C9H8O2 — CID 57312610
7,8a-dihydrochromen-8-one (PubChem CID 57312610) has the molecular formula C9H8O2 and a molecular weight of 148.16 g/mol. Its IUPAC name is 7,8a-dihydrochromen-8-one.
| Compound Name | 7,8a-dihydrochromen-8-one |
|---|---|
| PubChem CID | 57312610 |
| Molecular Formula | C9H8O2 |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.05 |
| IUPAC Name | 7,8a-dihydrochromen-8-one |
| SMILES | O=C1CC=CC2=CC=COC12 |
| InChI | InChI=1S/C9H8O2/c10-8-5-1-3-7-4-2-6-11-9(7)8/h1-4,6,9H,5H2 |
| InChIKey | XTSIWIWBDZEIEC-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |