C26H28F3N3O2 — CID 142224658
2-anilino-1-[(2Z,4Z)-hexa-2,4-dienyl]-7-propan-2-yloxy-5-(trifluoromethyl)-1,8-naphthyridin-4-one;ethene (PubChem CID 142224658) has the molecular formula C26H28F3N3O2 and a molecular weight of 471.52 g/mol. Its IUPAC name is 2-anilino-1-[(2Z,4Z)-hexa-2,4-dienyl]-7-propan-2-yloxy-5-(trifluoromethyl)-1,8-naphthyridin-4-one;ethene.
| Compound Name | 2-anilino-1-[(2Z,4Z)-hexa-2,4-dienyl]-7-propan-2-yloxy-5-(trifluoromethyl)-1,8-naphthyridin-4-one;ethene |
|---|---|
| PubChem CID | 142224658 |
| Molecular Formula | C26H28F3N3O2 |
| Molecular Weight | 471.52 g/mol |
| Exact Mass | 471.21 |
| IUPAC Name | 2-anilino-1-[(2Z,4Z)-hexa-2,4-dienyl]-7-propan-2-yloxy-5-(trifluoromethyl)-1,8-naphthyridin-4-one;ethene |
| SMILES | C/C=C\C=C/Cn1c(Nc2ccccc2)cc(=O)c2c(C(F)(F)F)cc(OC(C)C)nc21.C=C |
| InChI | InChI=1S/C24H24F3N3O2.C2H4/c1-4-5-6-10-13-30-20(28-17-11-8-7-9-12-17)15-19(31)22-18(24(25,26)27)14-21(29-23(22)30)32-16(2)3;1-2/h4-12,14-16,28H,13H2,1-3H3;1-2H2/b5-4-,10-6-; |
| InChIKey | BCXUVRFUNVIJAJ-ICHDRJDBSA-N |
| XLogP | 6.88 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.52 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|