C21H30FN3O2 — CID 142225127
N'-[(E)-2-fluoropent-2-enyl]ethanimidamide;5-methyl-3-phenyl-2-propan-2-yl-2,5-dihydro-1,4-oxazin-6-one (PubChem CID 142225127) has the molecular formula C21H30FN3O2 and a molecular weight of 375.49 g/mol. Its IUPAC name is N'-[(E)-2-fluoropent-2-enyl]ethanimidamide;5-methyl-3-phenyl-2-propan-2-yl-2,5-dihydro-1,4-oxazin-6-one.
| Compound Name | N'-[(E)-2-fluoropent-2-enyl]ethanimidamide;5-methyl-3-phenyl-2-propan-2-yl-2,5-dihydro-1,4-oxazin-6-one |
|---|---|
| PubChem CID | 142225127 |
| Molecular Formula | C21H30FN3O2 |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | N'-[(E)-2-fluoropent-2-enyl]ethanimidamide;5-methyl-3-phenyl-2-propan-2-yl-2,5-dihydro-1,4-oxazin-6-one |
| SMILES | CC/C=C(/F)C/N=C(\C)N.CC1N=C(c2ccccc2)C(C(C)C)OC1=O |
| InChI | InChI=1S/C14H17NO2.C7H13FN2/c1-9(2)13-12(11-7-5-4-6-8-11)15-10(3)14(16)17-13;1-3-4-7(8)5-10-6(2)9/h4-10,13H,1-3H3;4H,3,5H2,1-2H3,(H2,9,10)/b;7-4+ |
| InChIKey | CWTMSTHEAKCYKC-DNLQIICGSA-N |
| XLogP | 4.07 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|