C23H22F3N3O — CID 142225345
2-(cyclohexa-1,5-dien-1-ylamino)-1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-7-methyl-5-(trifluoromethyl)-1,8-naphthyridin-4-one (PubChem CID 142225345) has the molecular formula C23H22F3N3O and a molecular weight of 413.44 g/mol. Its IUPAC name is 2-(cyclohexa-1,5-dien-1-ylamino)-1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-7-methyl-5-(trifluoromethyl)-1,8-naphthyridin-4-one.
| Compound Name | 2-(cyclohexa-1,5-dien-1-ylamino)-1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-7-methyl-5-(trifluoromethyl)-1,8-naphthyridin-4-one |
|---|---|
| PubChem CID | 142225345 |
| Molecular Formula | C23H22F3N3O |
| Molecular Weight | 413.44 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | 2-(cyclohexa-1,5-dien-1-ylamino)-1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-7-methyl-5-(trifluoromethyl)-1,8-naphthyridin-4-one |
| SMILES | C=C/C=C(\C=C/C)n1c(NC2=CCCC=C2)cc(=O)c2c(C(F)(F)F)cc(C)nc21 |
| InChI | InChI=1S/C23H22F3N3O/c1-4-9-17(10-5-2)29-20(28-16-11-7-6-8-12-16)14-19(30)21-18(23(24,25)26)13-15(3)27-22(21)29/h4-5,7,9-14,28H,1,6,8H2,2-3H3/b10-5-,17-9+ |
| InChIKey | VBPYCGDSNHCINP-TWTFLKADSA-N |
| XLogP | 5.97 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.44 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|