C12H20N2S — CID 142225906
4-(2,3-dimethylbutan-2-yl)pyridine;methanethioamide (PubChem CID 142225906) has the molecular formula C12H20N2S and a molecular weight of 224.37 g/mol. Its IUPAC name is 4-(2,3-dimethylbutan-2-yl)pyridine;methanethioamide.
| Compound Name | 4-(2,3-dimethylbutan-2-yl)pyridine;methanethioamide |
|---|---|
| PubChem CID | 142225906 |
| Molecular Formula | C12H20N2S |
| Molecular Weight | 224.37 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 4-(2,3-dimethylbutan-2-yl)pyridine;methanethioamide |
| SMILES | CC(C)C(C)(C)c1ccncc1.NC=S |
| InChI | InChI=1S/C11H17N.CH3NS/c1-9(2)11(3,4)10-5-7-12-8-6-10;2-1-3/h5-9H,1-4H3;1H,(H2,2,3) |
| InChIKey | YQNWIHLIESMFPA-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.37 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|