C10H17N — CID 142226991
4,5-dimethyl-3H-azepine;ethane (PubChem CID 142226991) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is 4,5-dimethyl-3H-azepine;ethane.
| Compound Name | 4,5-dimethyl-3H-azepine;ethane |
|---|---|
| PubChem CID | 142226991 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 4,5-dimethyl-3H-azepine;ethane |
| SMILES | CC.CC1=C(C)CC=NC=C1 |
| InChI | InChI=1S/C8H11N.C2H6/c1-7-3-5-9-6-4-8(7)2;1-2/h3,5-6H,4H2,1-2H3;1-2H3 |
| InChIKey | REOOGEPWSOHXJY-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |