C15H25NO2 — CID 142227627
4-(3-aminobutyl)phenol;2,2-dimethylpropanal (PubChem CID 142227627) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is 4-(3-aminobutyl)phenol;2,2-dimethylpropanal.
| Compound Name | 4-(3-aminobutyl)phenol;2,2-dimethylpropanal |
|---|---|
| PubChem CID | 142227627 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | 4-(3-aminobutyl)phenol;2,2-dimethylpropanal |
| SMILES | CC(C)(C)C=O.CC(N)CCc1ccc(O)cc1 |
| InChI | InChI=1S/C10H15NO.C5H10O/c1-8(11)2-3-9-4-6-10(12)7-5-9;1-5(2,3)4-6/h4-8,12H,2-3,11H2,1H3;4H,1-3H3 |
| InChIKey | XYCBQROAUIGZFT-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|