C20H34N4 — CID 142228723
N'-[N'-(cyclohexylmethyl)-N-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]carbamimidoyl]-N,N-dimethylethanimidamide (PubChem CID 142228723) has the molecular formula C20H34N4 and a molecular weight of 330.52 g/mol. Its IUPAC name is N'-[N'-(cyclohexylmethyl)-N-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]carbamimidoyl]-N,N-dimethylethanimidamide.
| Compound Name | N'-[N'-(cyclohexylmethyl)-N-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]carbamimidoyl]-N,N-dimethylethanimidamide |
|---|---|
| PubChem CID | 142228723 |
| Molecular Formula | C20H34N4 |
| Molecular Weight | 330.52 g/mol |
| Exact Mass | 330.28 |
| IUPAC Name | N'-[N'-(cyclohexylmethyl)-N-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]carbamimidoyl]-N,N-dimethylethanimidamide |
| SMILES | C/C=C\C=C(/C=C\C)NC(=N/CC1CCCCC1)/N=C(\C)N(C)C |
| InChI | InChI=1S/C20H34N4/c1-6-8-15-19(12-7-2)23-20(22-17(3)24(4)5)21-16-18-13-10-9-11-14-18/h6-8,12,15,18H,9-11,13-14,16H2,1-5H3,(H,21,23)/b8-6-,12-7-,19-15+,22-17+ |
| InChIKey | XQHRTTSIVIUDKB-QNCCDVAUSA-N |
| XLogP | 4.53 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.52 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|