C28H45N5 — CID 142229542
N-[3-[[(Z)-but-2-enyl]-methylamino]but-3-enyl]-N'-[N'-(cyclohexylmethyl)-N-[(3Z,5Z)-octa-1,3,5,7-tetraen-2-yl]carbamimidoyl]-N-methylethanimidamide (PubChem CID 142229542) has the molecular formula C28H45N5 and a molecular weight of 451.70 g/mol. Its IUPAC name is N-[3-[[(Z)-but-2-enyl]-methylamino]but-3-enyl]-N'-[N'-(cyclohexylmethyl)-N-[(3Z,5Z)-octa-1,3,5,7-tetraen-2-yl]carbamimidoyl]-N-methylethanimidamide.
| Compound Name | N-[3-[[(Z)-but-2-enyl]-methylamino]but-3-enyl]-N'-[N'-(cyclohexylmethyl)-N-[(3Z,5Z)-octa-1,3,5,7-tetraen-2-yl]carbamimidoyl]-N-methylethanimidamide |
|---|---|
| PubChem CID | 142229542 |
| Molecular Formula | C28H45N5 |
| Molecular Weight | 451.70 g/mol |
| Exact Mass | 451.37 |
| IUPAC Name | N-[3-[[(Z)-but-2-enyl]-methylamino]but-3-enyl]-N'-[N'-(cyclohexylmethyl)-N-[(3Z,5Z)-octa-1,3,5,7-tetraen-2-yl]carbamimidoyl]-N-methylethanimidamide |
| SMILES | C=C/C=C\C=C/C(=C)NC(=N/CC1CCCCC1)/N=C(\C)N(C)CCC(=C)N(C)C/C=C\C |
| InChI | InChI=1S/C28H45N5/c1-8-10-12-14-17-24(3)30-28(29-23-27-18-15-13-16-19-27)31-26(5)33(7)22-20-25(4)32(6)21-11-9-2/h8-12,14,17,27H,1,3-4,13,15-16,18-23H2,2,5-7H3,(H,29,30)/b11-9-,12-10-,17-14-,31-26+ |
| InChIKey | NQPNKBHZNQLHBU-QIPPSKLQSA-N |
| XLogP | 6.09 |
| TPSA | 43.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.70 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|