C20H32N4 — CID 142230604
4-N,4-N-dimethyl-2-N-[(4S)-4-methyloctyl]-8H-cyclohepta[d]pyrimidine-2,4-diamine (PubChem CID 142230604) has the molecular formula C20H32N4 and a molecular weight of 328.50 g/mol. Its IUPAC name is 4-N,4-N-dimethyl-2-N-[(4S)-4-methyloctyl]-8H-cyclohepta[d]pyrimidine-2,4-diamine.
| Compound Name | 4-N,4-N-dimethyl-2-N-[(4S)-4-methyloctyl]-8H-cyclohepta[d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 142230604 |
| Molecular Formula | C20H32N4 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.26 |
| IUPAC Name | 4-N,4-N-dimethyl-2-N-[(4S)-4-methyloctyl]-8H-cyclohepta[d]pyrimidine-2,4-diamine |
| SMILES | CCCC[C@H](C)CCCNc1nc(N(C)C)c2c(n1)=CCC=CC=2 |
| InChI | InChI=1S/C20H32N4/c1-5-6-11-16(2)12-10-15-21-20-22-18-14-9-7-8-13-17(18)19(23-20)24(3)4/h7-8,13-14,16H,5-6,9-12,15H2,1-4H3,(H,21,22)/t16-/m0/s1 |
| InChIKey | FUAZUZHVMHHOEU-INIZCTEOSA-N |
| XLogP | 3.08 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|