C18H26N4 — CID 142228836
3-N-(cyclohexylmethyl)-5-N-methyl-2,4-diazabicyclo[5.5.0]dodeca-7,9,11-triene-3,5-diimine (PubChem CID 142228836) has the molecular formula C18H26N4 and a molecular weight of 298.43 g/mol. Its IUPAC name is 3-N-(cyclohexylmethyl)-5-N-methyl-2,4-diazabicyclo[5.5.0]dodeca-7,9,11-triene-3,5-diimine.
| Compound Name | 3-N-(cyclohexylmethyl)-5-N-methyl-2,4-diazabicyclo[5.5.0]dodeca-7,9,11-triene-3,5-diimine |
|---|---|
| PubChem CID | 142228836 |
| Molecular Formula | C18H26N4 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.22 |
| IUPAC Name | 3-N-(cyclohexylmethyl)-5-N-methyl-2,4-diazabicyclo[5.5.0]dodeca-7,9,11-triene-3,5-diimine |
| SMILES | C/N=C1\CC2=CC=CC=CC2N/C(=N/CC2CCCCC2)N1 |
| InChI | InChI=1S/C18H26N4/c1-19-17-12-15-10-6-3-7-11-16(15)21-18(22-17)20-13-14-8-4-2-5-9-14/h3,6-7,10-11,14,16H,2,4-5,8-9,12-13H2,1H3,(H2,19,20,21,22) |
| InChIKey | LKGMNBKOXGPNMU-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|