C19H28N4 — CID 142228503
2-N-(cyclohexylmethyl)-4-N-propan-2-yl-1,9a-dihydrocyclohepta[d]pyrimidine-2,4-diimine (PubChem CID 142228503) has the molecular formula C19H28N4 and a molecular weight of 312.46 g/mol. Its IUPAC name is 2-N-(cyclohexylmethyl)-4-N-propan-2-yl-1,9a-dihydrocyclohepta[d]pyrimidine-2,4-diimine.
| Compound Name | 2-N-(cyclohexylmethyl)-4-N-propan-2-yl-1,9a-dihydrocyclohepta[d]pyrimidine-2,4-diimine |
|---|---|
| PubChem CID | 142228503 |
| Molecular Formula | C19H28N4 |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | 2-N-(cyclohexylmethyl)-4-N-propan-2-yl-1,9a-dihydrocyclohepta[d]pyrimidine-2,4-diimine |
| SMILES | CC(C)/N=C1\N/C(=N\CC2CCCCC2)NC2C=CC=CC=C12 |
| InChI | InChI=1S/C19H28N4/c1-14(2)21-18-16-11-7-4-8-12-17(16)22-19(23-18)20-13-15-9-5-3-6-10-15/h4,7-8,11-12,14-15,17H,3,5-6,9-10,13H2,1-2H3,(H2,20,21,22,23) |
| InChIKey | GJOZIVPCJKECGU-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|