C19H30N4 — CID 142230397
(4aE,7Z)-2-(cyclohexylmethylimino)-N,N-dimethyl-6,9,10,10a-tetrahydro-1H-cycloocta[d]pyrimidin-4-amine (PubChem CID 142230397) has the molecular formula C19H30N4 and a molecular weight of 314.48 g/mol. Its IUPAC name is (4aE,7Z)-2-(cyclohexylmethylimino)-N,N-dimethyl-6,9,10,10a-tetrahydro-1H-cycloocta[d]pyrimidin-4-amine.
| Compound Name | (4aE,7Z)-2-(cyclohexylmethylimino)-N,N-dimethyl-6,9,10,10a-tetrahydro-1H-cycloocta[d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 142230397 |
| Molecular Formula | C19H30N4 |
| Molecular Weight | 314.48 g/mol |
| Exact Mass | 314.25 |
| IUPAC Name | (4aE,7Z)-2-(cyclohexylmethylimino)-N,N-dimethyl-6,9,10,10a-tetrahydro-1H-cycloocta[d]pyrimidin-4-amine |
| SMILES | CN(C)C1=N/C(=N\CC2CCCCC2)NC2CC/C=C\C/C=C/12 |
| InChI | InChI=1S/C19H30N4/c1-23(2)18-16-12-8-3-4-9-13-17(16)21-19(22-18)20-14-15-10-6-5-7-11-15/h3-4,12,15,17H,5-11,13-14H2,1-2H3,(H,20,21)/b4-3-,16-12+ |
| InChIKey | GVOHVXOIDFEMPI-RDYGQBFWSA-N |
| XLogP | 3.52 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.48 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|