C17H32N6 — CID 163694350
(5S)-5-N-[[(1S,4S,5R)-5-amino-2,4-dimethylcyclohex-2-en-1-yl]methyl]-4-N,4-N,5-N-trimethyl-2-methylimino-5,6-dihydro-1H-pyrimidine-4,5-diamine (PubChem CID 163694350) has the molecular formula C17H32N6 and a molecular weight of 320.49 g/mol. Its IUPAC name is (5S)-5-N-[[(1S,4S,5R)-5-amino-2,4-dimethylcyclohex-2-en-1-yl]methyl]-4-N,4-N,5-N-trimethyl-2-methylimino-5,6-dihydro-1H-pyrimidine-4,5-diamine.
| Compound Name | (5S)-5-N-[[(1S,4S,5R)-5-amino-2,4-dimethylcyclohex-2-en-1-yl]methyl]-4-N,4-N,5-N-trimethyl-2-methylimino-5,6-dihydro-1H-pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 163694350 |
| Molecular Formula | C17H32N6 |
| Molecular Weight | 320.49 g/mol |
| Exact Mass | 320.27 |
| IUPAC Name | (5S)-5-N-[[(1S,4S,5R)-5-amino-2,4-dimethylcyclohex-2-en-1-yl]methyl]-4-N,4-N,5-N-trimethyl-2-methylimino-5,6-dihydro-1H-pyrimidine-4,5-diamine |
| SMILES | C/N=C1\N=C(N(C)C)[C@@H](N(C)C[C@H]2C[C@@H](N)[C@@H](C)C=C2C)CN1 |
| InChI | InChI=1S/C17H32N6/c1-11-7-12(2)14(18)8-13(11)10-23(6)15-9-20-17(19-3)21-16(15)22(4)5/h7,12-15H,8-10,18H2,1-6H3,(H,19,20)/t12-,13+,14+,15-/m0/s1 |
| InChIKey | JVQJZJDCWQQZNE-YJNKXOJESA-N |
| XLogP | 0.77 |
| TPSA | 69.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.49 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|