C17H32N4 — CID 103277941
1-[2-(diethylamino)ethyl]-5-(3,5-dimethylcyclohex-3-en-1-yl)-4,5-dihydroimidazol-2-amine (PubChem CID 103277941) has the molecular formula C17H32N4 and a molecular weight of 292.47 g/mol. Its IUPAC name is 1-[2-(diethylamino)ethyl]-5-(3,5-dimethylcyclohex-3-en-1-yl)-4,5-dihydroimidazol-2-amine.
| Compound Name | 1-[2-(diethylamino)ethyl]-5-(3,5-dimethylcyclohex-3-en-1-yl)-4,5-dihydroimidazol-2-amine |
|---|---|
| PubChem CID | 103277941 |
| Molecular Formula | C17H32N4 |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.26 |
| IUPAC Name | 1-[2-(diethylamino)ethyl]-5-(3,5-dimethylcyclohex-3-en-1-yl)-4,5-dihydroimidazol-2-amine |
| SMILES | CCN(CC)CCN1C(N)=NCC1C1CC(C)=CC(C)C1 |
| InChI | InChI=1S/C17H32N4/c1-5-20(6-2)7-8-21-16(12-19-17(21)18)15-10-13(3)9-14(4)11-15/h9,13,15-16H,5-8,10-12H2,1-4H3,(H2,18,19) |
| InChIKey | CQZYKGGOQCFFFL-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|