C21H42N6 — CID 176543596
(2S)-2-amino-N-[(2R,3R)-3-[(5S)-2-[(1S)-1-amino-2-methylpropyl]-6-[(Z)-but-1-enyl]-1,4,5,6-tetrahydropyrimidin-5-yl]butan-2-yl]-3-methylbutanimidamide (PubChem CID 176543596) has the molecular formula C21H42N6 and a molecular weight of 378.61 g/mol. Its IUPAC name is (2S)-2-amino-N-[(2R,3R)-3-[(5S)-2-[(1S)-1-amino-2-methylpropyl]-6-[(Z)-but-1-enyl]-1,4,5,6-tetrahydropyrimidin-5-yl]butan-2-yl]-3-methylbutanimidamide.
| Compound Name | (2S)-2-amino-N-[(2R,3R)-3-[(5S)-2-[(1S)-1-amino-2-methylpropyl]-6-[(Z)-but-1-enyl]-1,4,5,6-tetrahydropyrimidin-5-yl]butan-2-yl]-3-methylbutanimidamide |
|---|---|
| PubChem CID | 176543596 |
| Molecular Formula | C21H42N6 |
| Molecular Weight | 378.61 g/mol |
| Exact Mass | 378.35 |
| IUPAC Name | (2S)-2-amino-N-[(2R,3R)-3-[(5S)-2-[(1S)-1-amino-2-methylpropyl]-6-[(Z)-but-1-enyl]-1,4,5,6-tetrahydropyrimidin-5-yl]butan-2-yl]-3-methylbutanimidamide |
| SMILES | [H]/N=C(/N[C@H](C)[C@H](C)[C@H]1CN=C([C@@H](N)C(C)C)NC1/C=C\CC)[C@@H](N)C(C)C |
| InChI | InChI=1S/C21H42N6/c1-8-9-10-17-16(11-25-21(27-17)19(23)13(4)5)14(6)15(7)26-20(24)18(22)12(2)3/h9-10,12-19H,8,11,22-23H2,1-7H3,(H2,24,26)(H,25,27)/b10-9-/t14-,15+,16+,17?,18-,19-/m0/s1 |
| InChIKey | VEKSWLYKPYDCOD-JGHDANTISA-N |
| XLogP | 2.50 |
| TPSA | 112.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.61 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|