C23H20F3N5OS — CID 142229434
4-N,4-N-dimethyl-2-N-[4-[[2-(trifluoromethoxy)phenyl]sulfanylamino]phenyl]quinazoline-2,4-diamine (PubChem CID 142229434) has the molecular formula C23H20F3N5OS and a molecular weight of 471.51 g/mol. Its IUPAC name is 4-N,4-N-dimethyl-2-N-[4-[[2-(trifluoromethoxy)phenyl]sulfanylamino]phenyl]quinazoline-2,4-diamine.
| Compound Name | 4-N,4-N-dimethyl-2-N-[4-[[2-(trifluoromethoxy)phenyl]sulfanylamino]phenyl]quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 142229434 |
| Molecular Formula | C23H20F3N5OS |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | 4-N,4-N-dimethyl-2-N-[4-[[2-(trifluoromethoxy)phenyl]sulfanylamino]phenyl]quinazoline-2,4-diamine |
| SMILES | CN(C)c1nc(Nc2ccc(NSc3ccccc3OC(F)(F)F)cc2)nc2ccccc12 |
| InChI | InChI=1S/C23H20F3N5OS/c1-31(2)21-17-7-3-4-8-18(17)28-22(29-21)27-15-11-13-16(14-12-15)30-33-20-10-6-5-9-19(20)32-23(24,25)26/h3-14,30H,1-2H3,(H,27,28,29) |
| InChIKey | IJVIFMJKIYFVFW-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|