C15H15N5 — CID 71691122
4-N,4-N-dimethyl-2-N-pyridin-3-ylquinazoline-2,4-diamine (PubChem CID 71691122) has the molecular formula C15H15N5 and a molecular weight of 265.32 g/mol. Its IUPAC name is 4-N,4-N-dimethyl-2-N-pyridin-3-ylquinazoline-2,4-diamine.
| Compound Name | 4-N,4-N-dimethyl-2-N-pyridin-3-ylquinazoline-2,4-diamine |
|---|---|
| PubChem CID | 71691122 |
| Molecular Formula | C15H15N5 |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 4-N,4-N-dimethyl-2-N-pyridin-3-ylquinazoline-2,4-diamine |
| SMILES | CN(C)c1nc(Nc2cccnc2)nc2ccccc12 |
| InChI | InChI=1S/C15H15N5/c1-20(2)14-12-7-3-4-8-13(12)18-15(19-14)17-11-6-5-9-16-10-11/h3-10H,1-2H3,(H,17,18,19) |
| InChIKey | LBDCHLAIEZXJRR-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |