C7H7N3O — CID 14223001
2,5-dimethyl-3-oxopyridazine-4-carbonitrile (PubChem CID 14223001) has the molecular formula C7H7N3O and a molecular weight of 149.15 g/mol. Its IUPAC name is 2,5-dimethyl-3-oxopyridazine-4-carbonitrile.
| Compound Name | 2,5-dimethyl-3-oxopyridazine-4-carbonitrile |
|---|---|
| PubChem CID | 14223001 |
| Molecular Formula | C7H7N3O |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.06 |
| IUPAC Name | 2,5-dimethyl-3-oxopyridazine-4-carbonitrile |
| SMILES | Cc1cnn(C)c(=O)c1C#N |
| InChI | InChI=1S/C7H7N3O/c1-5-4-9-10(2)7(11)6(5)3-8/h4H,1-2H3 |
| InChIKey | VXXKWHHEJFPONP-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |