C15H22ClF3N2S — CID 142230865
N-[2-chloro-5-(trifluoromethyl)phenyl]sulfanylmethanamine;cyclohexylmethanamine (PubChem CID 142230865) has the molecular formula C15H22ClF3N2S and a molecular weight of 354.87 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)phenyl]sulfanylmethanamine;cyclohexylmethanamine.
| Compound Name | N-[2-chloro-5-(trifluoromethyl)phenyl]sulfanylmethanamine;cyclohexylmethanamine |
|---|---|
| PubChem CID | 142230865 |
| Molecular Formula | C15H22ClF3N2S |
| Molecular Weight | 354.87 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)phenyl]sulfanylmethanamine;cyclohexylmethanamine |
| SMILES | CNSc1cc(C(F)(F)F)ccc1Cl.NCC1CCCCC1 |
| InChI | InChI=1S/C8H7ClF3NS.C7H15N/c1-13-14-7-4-5(8(10,11)12)2-3-6(7)9;8-6-7-4-2-1-3-5-7/h2-4,13H,1H3;7H,1-6,8H2 |
| InChIKey | PZGVBDZSZYKSKN-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.87 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|