C23H24ClF2N5O — CID 142231025
2-chloro-N-[[1-[4-(dimethylamino)quinazolin-2-yl]piperidin-4-yl]methyl]-3,6-difluorobenzamide (PubChem CID 142231025) has the molecular formula C23H24ClF2N5O and a molecular weight of 459.93 g/mol. Its IUPAC name is 2-chloro-N-[[1-[4-(dimethylamino)quinazolin-2-yl]piperidin-4-yl]methyl]-3,6-difluorobenzamide.
| Compound Name | 2-chloro-N-[[1-[4-(dimethylamino)quinazolin-2-yl]piperidin-4-yl]methyl]-3,6-difluorobenzamide |
|---|---|
| PubChem CID | 142231025 |
| Molecular Formula | C23H24ClF2N5O |
| Molecular Weight | 459.93 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | 2-chloro-N-[[1-[4-(dimethylamino)quinazolin-2-yl]piperidin-4-yl]methyl]-3,6-difluorobenzamide |
| SMILES | CN(C)c1nc(N2CCC(CNC(=O)c3c(F)ccc(F)c3Cl)CC2)nc2ccccc12 |
| InChI | InChI=1S/C23H24ClF2N5O/c1-30(2)21-15-5-3-4-6-18(15)28-23(29-21)31-11-9-14(10-12-31)13-27-22(32)19-16(25)7-8-17(26)20(19)24/h3-8,14H,9-13H2,1-2H3,(H,27,32) |
| InChIKey | HNZPUKAMTJNTEJ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.93 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|