C24H30ClN5O — CID 142229210
4-chloro-N-(cyclohexylmethyl)benzamide;4-N,4-N-dimethylquinazoline-2,4-diamine (PubChem CID 142229210) has the molecular formula C24H30ClN5O and a molecular weight of 439.99 g/mol. Its IUPAC name is 4-chloro-N-(cyclohexylmethyl)benzamide;4-N,4-N-dimethylquinazoline-2,4-diamine.
| Compound Name | 4-chloro-N-(cyclohexylmethyl)benzamide;4-N,4-N-dimethylquinazoline-2,4-diamine |
|---|---|
| PubChem CID | 142229210 |
| Molecular Formula | C24H30ClN5O |
| Molecular Weight | 439.99 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | 4-chloro-N-(cyclohexylmethyl)benzamide;4-N,4-N-dimethylquinazoline-2,4-diamine |
| SMILES | CN(C)c1nc(N)nc2ccccc12.O=C(NCC1CCCCC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H18ClNO.C10H12N4/c15-13-8-6-12(7-9-13)14(17)16-10-11-4-2-1-3-5-11;1-14(2)9-7-5-3-4-6-8(7)12-10(11)13-9/h6-9,11H,1-5,10H2,(H,16,17);3-6H,1-2H3,(H2,11,12,13) |
| InChIKey | WARUOUMOVGWHJV-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.99 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |