C23H30BrN5S — CID 142231487
N-(2-bromophenyl)sulfanylmethanamine;2-N-(cyclohexylmethyl)-4-N-methylquinazoline-2,4-diamine (PubChem CID 142231487) has the molecular formula C23H30BrN5S and a molecular weight of 488.50 g/mol. Its IUPAC name is N-(2-bromophenyl)sulfanylmethanamine;2-N-(cyclohexylmethyl)-4-N-methylquinazoline-2,4-diamine.
| Compound Name | N-(2-bromophenyl)sulfanylmethanamine;2-N-(cyclohexylmethyl)-4-N-methylquinazoline-2,4-diamine |
|---|---|
| PubChem CID | 142231487 |
| Molecular Formula | C23H30BrN5S |
| Molecular Weight | 488.50 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | N-(2-bromophenyl)sulfanylmethanamine;2-N-(cyclohexylmethyl)-4-N-methylquinazoline-2,4-diamine |
| SMILES | CNSc1ccccc1Br.CNc1nc(NCC2CCCCC2)nc2ccccc12 |
| InChI | InChI=1S/C16H22N4.C7H8BrNS/c1-17-15-13-9-5-6-10-14(13)19-16(20-15)18-11-12-7-3-2-4-8-12;1-9-10-7-5-3-2-4-6(7)8/h5-6,9-10,12H,2-4,7-8,11H2,1H3,(H2,17,18,19,20);2-5,9H,1H3 |
| InChIKey | PCWORBPQAXLYON-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 61.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.50 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|