C18H24N2O2 — CID 142231611
N-(4-methylcyclohexyl)-2-oxo-2-[4-[(1Z,3Z)-penta-1,3-dienyl]-1H-pyrrol-3-yl]acetamide (PubChem CID 142231611) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is N-(4-methylcyclohexyl)-2-oxo-2-[4-[(1Z,3Z)-penta-1,3-dienyl]-1H-pyrrol-3-yl]acetamide.
| Compound Name | N-(4-methylcyclohexyl)-2-oxo-2-[4-[(1Z,3Z)-penta-1,3-dienyl]-1H-pyrrol-3-yl]acetamide |
|---|---|
| PubChem CID | 142231611 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | N-(4-methylcyclohexyl)-2-oxo-2-[4-[(1Z,3Z)-penta-1,3-dienyl]-1H-pyrrol-3-yl]acetamide |
| SMILES | C/C=C\C=C/c1c[nH]cc1C(=O)C(=O)NC1CCC(C)CC1 |
| InChI | InChI=1S/C18H24N2O2/c1-3-4-5-6-14-11-19-12-16(14)17(21)18(22)20-15-9-7-13(2)8-10-15/h3-6,11-13,15,19H,7-10H2,1-2H3,(H,20,22)/b4-3-,6-5- |
| InChIKey | FDDFPMHPAXCXKI-OUPQRBNQSA-N |
| XLogP | 3.48 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|