C14H25NO3S — CID 95652956
(2S)-2-[(E)-but-2-enyl]sulfonyl-N-(4-methylcyclohexyl)propanamide (PubChem CID 95652956) has the molecular formula C14H25NO3S and a molecular weight of 287.42 g/mol. Its IUPAC name is (2S)-2-[(E)-but-2-enyl]sulfonyl-N-(4-methylcyclohexyl)propanamide.
| Compound Name | (2S)-2-[(E)-but-2-enyl]sulfonyl-N-(4-methylcyclohexyl)propanamide |
|---|---|
| PubChem CID | 95652956 |
| Molecular Formula | C14H25NO3S |
| Molecular Weight | 287.42 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | (2S)-2-[(E)-but-2-enyl]sulfonyl-N-(4-methylcyclohexyl)propanamide |
| SMILES | C/C=C/CS(=O)(=O)[C@@H](C)C(=O)NC1CCC(C)CC1 |
| InChI | InChI=1S/C14H25NO3S/c1-4-5-10-19(17,18)12(3)14(16)15-13-8-6-11(2)7-9-13/h4-5,11-13H,6-10H2,1-3H3,(H,15,16)/b5-4+/t11?,12-,13?/m0/s1 |
| InChIKey | LJVOBRHKBDXQKG-QGVCGZFUSA-N |
| XLogP | 2.06 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.42 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|