C9H15NO3S — CID 76865490
2-but-2-enylsulfonyl-N-cyclopropylacetamide (PubChem CID 76865490) has the molecular formula C9H15NO3S and a molecular weight of 217.29 g/mol. Its IUPAC name is 2-but-2-enylsulfonyl-N-cyclopropylacetamide.
| Compound Name | 2-but-2-enylsulfonyl-N-cyclopropylacetamide |
|---|---|
| PubChem CID | 76865490 |
| Molecular Formula | C9H15NO3S |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.08 |
| IUPAC Name | 2-but-2-enylsulfonyl-N-cyclopropylacetamide |
| SMILES | CC=CCS(=O)(=O)CC(=O)NC1CC1 |
| InChI | InChI=1S/C9H15NO3S/c1-2-3-6-14(12,13)7-9(11)10-8-4-5-8/h2-3,8H,4-7H2,1H3,(H,10,11) |
| InChIKey | QIOPRDBKBQIANO-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|