C11H19NO5S — CID 114232365
methyl 3-[2-(cyclopropylamino)-2-oxoethyl]sulfonyl-2-methylbutanoate (PubChem CID 114232365) has the molecular formula C11H19NO5S and a molecular weight of 277.34 g/mol. Its IUPAC name is methyl 3-[2-(cyclopropylamino)-2-oxoethyl]sulfonyl-2-methylbutanoate.
| Compound Name | methyl 3-[2-(cyclopropylamino)-2-oxoethyl]sulfonyl-2-methylbutanoate |
|---|---|
| PubChem CID | 114232365 |
| Molecular Formula | C11H19NO5S |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | methyl 3-[2-(cyclopropylamino)-2-oxoethyl]sulfonyl-2-methylbutanoate |
| SMILES | COC(=O)C(C)C(C)S(=O)(=O)CC(=O)NC1CC1 |
| InChI | InChI=1S/C11H19NO5S/c1-7(11(14)17-3)8(2)18(15,16)6-10(13)12-9-4-5-9/h7-9H,4-6H2,1-3H3,(H,12,13) |
| InChIKey | IEPKWCODOVUOCS-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |