C12H21N3O3S — CID 142231720
3-[[2-[aminomethyl(ethyl)amino]acetyl]amino]thiophene-2-carboxylic acid;ethane (PubChem CID 142231720) has the molecular formula C12H21N3O3S and a molecular weight of 287.39 g/mol. Its IUPAC name is 3-[[2-[aminomethyl(ethyl)amino]acetyl]amino]thiophene-2-carboxylic acid;ethane.
| Compound Name | 3-[[2-[aminomethyl(ethyl)amino]acetyl]amino]thiophene-2-carboxylic acid;ethane |
|---|---|
| PubChem CID | 142231720 |
| Molecular Formula | C12H21N3O3S |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 3-[[2-[aminomethyl(ethyl)amino]acetyl]amino]thiophene-2-carboxylic acid;ethane |
| SMILES | CC.CCN(CN)CC(=O)Nc1ccsc1C(=O)O |
| InChI | InChI=1S/C10H15N3O3S.C2H6/c1-2-13(6-11)5-8(14)12-7-3-4-17-9(7)10(15)16;1-2/h3-4H,2,5-6,11H2,1H3,(H,12,14)(H,15,16);1-2H3 |
| InChIKey | RYBWPOVFSDRGBW-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|