C27H41FN4O — CID 142233381
N-[(1S)-3-[4-(4-amino-2-ethyliminohex-3-en-3-yl)piperidin-1-yl]-1-(3-fluorophenyl)propyl]cyclobutanecarboxamide (PubChem CID 142233381) has the molecular formula C27H41FN4O and a molecular weight of 456.65 g/mol. Its IUPAC name is N-[(1S)-3-[4-(4-amino-2-ethyliminohex-3-en-3-yl)piperidin-1-yl]-1-(3-fluorophenyl)propyl]cyclobutanecarboxamide.
| Compound Name | N-[(1S)-3-[4-(4-amino-2-ethyliminohex-3-en-3-yl)piperidin-1-yl]-1-(3-fluorophenyl)propyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 142233381 |
| Molecular Formula | C27H41FN4O |
| Molecular Weight | 456.65 g/mol |
| Exact Mass | 456.33 |
| IUPAC Name | N-[(1S)-3-[4-(4-amino-2-ethyliminohex-3-en-3-yl)piperidin-1-yl]-1-(3-fluorophenyl)propyl]cyclobutanecarboxamide |
| SMILES | CC/N=C(\C)C(=C(N)CC)C1CCN(CC[C@H](NC(=O)C2CCC2)c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C27H41FN4O/c1-4-24(29)26(19(3)30-5-2)20-12-15-32(16-13-20)17-14-25(22-10-7-11-23(28)18-22)31-27(33)21-8-6-9-21/h7,10-11,18,20-21,25H,4-6,8-9,12-17,29H2,1-3H3,(H,31,33)/b26-24?,30-19+/t25-/m0/s1 |
| InChIKey | WPPBWHRNLOVBKO-OEBJJJRHSA-N |
| XLogP | 4.99 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.65 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|