C28H37N3O2 — CID 23570398
N-[1-phenyl-3-[4-(2-phenylpropanoylamino)piperidin-1-yl]propyl]cyclobutanecarboxamide (PubChem CID 23570398) has the molecular formula C28H37N3O2 and a molecular weight of 447.62 g/mol. Its IUPAC name is N-[1-phenyl-3-[4-(2-phenylpropanoylamino)piperidin-1-yl]propyl]cyclobutanecarboxamide.
| Compound Name | N-[1-phenyl-3-[4-(2-phenylpropanoylamino)piperidin-1-yl]propyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 23570398 |
| Molecular Formula | C28H37N3O2 |
| Molecular Weight | 447.62 g/mol |
| Exact Mass | 447.29 |
| IUPAC Name | N-[1-phenyl-3-[4-(2-phenylpropanoylamino)piperidin-1-yl]propyl]cyclobutanecarboxamide |
| SMILES | CC(C(=O)NC1CCN(CCC(NC(=O)C2CCC2)c2ccccc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C28H37N3O2/c1-21(22-9-4-2-5-10-22)27(32)29-25-15-18-31(19-16-25)20-17-26(23-11-6-3-7-12-23)30-28(33)24-13-8-14-24/h2-7,9-12,21,24-26H,8,13-20H2,1H3,(H,29,32)(H,30,33) |
| InChIKey | OMYVPMMZVZEEEB-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.62 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |