C13H28N3+ — CID 142233744
[(Z)-aminomethylideneamino]methyl-[(2-propan-2-ylcycloheptyl)methyl]azanium (PubChem CID 142233744) has the molecular formula C13H28N3+ and a molecular weight of 226.39 g/mol. Its IUPAC name is [(Z)-aminomethylideneamino]methyl-[(2-propan-2-ylcycloheptyl)methyl]azanium.
| Compound Name | [(Z)-aminomethylideneamino]methyl-[(2-propan-2-ylcycloheptyl)methyl]azanium |
|---|---|
| PubChem CID | 142233744 |
| Molecular Formula | C13H28N3+ |
| Molecular Weight | 226.39 g/mol |
| Exact Mass | 226.23 |
| IUPAC Name | [(Z)-aminomethylideneamino]methyl-[(2-propan-2-ylcycloheptyl)methyl]azanium |
| SMILES | CC(C)C1CCCCCC1C[NH2+]C/N=C\N |
| InChI | InChI=1S/C13H27N3/c1-11(2)13-7-5-3-4-6-12(13)8-15-10-16-9-14/h9,11-13,15H,3-8,10H2,1-2H3,(H2,14,16)/p+1 |
| InChIKey | YOFIFNSBZBNNBQ-UHFFFAOYSA-O |
| XLogP | 1.35 |
| TPSA | 54.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.39 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|