C10H21N — CID 166498577
[(1R,2S)-2-propan-2-ylcyclohexyl]methanamine (PubChem CID 166498577) has the molecular formula C10H21N and a molecular weight of 155.28 g/mol. Its IUPAC name is [(1R,2S)-2-propan-2-ylcyclohexyl]methanamine.
| Compound Name | [(1R,2S)-2-propan-2-ylcyclohexyl]methanamine |
|---|---|
| PubChem CID | 166498577 |
| Molecular Formula | C10H21N |
| Molecular Weight | 155.28 g/mol |
| Exact Mass | 155.17 |
| IUPAC Name | [(1R,2S)-2-propan-2-ylcyclohexyl]methanamine |
| SMILES | CC(C)[C@@H]1CCCC[C@H]1CN |
| InChI | InChI=1S/C10H21N/c1-8(2)10-6-4-3-5-9(10)7-11/h8-10H,3-7,11H2,1-2H3/t9-,10-/m0/s1 |
| InChIKey | GVANMYJSYDXIHP-UWVGGRQHSA-N |
| XLogP | 2.41 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.28 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |