C23H31FN2O3 — CID 142235239
N-(4-fluorophenyl)formamide;4-(4-phenylmethoxypiperidin-1-yl)butan-1-ol (PubChem CID 142235239) has the molecular formula C23H31FN2O3 and a molecular weight of 402.51 g/mol. Its IUPAC name is N-(4-fluorophenyl)formamide;4-(4-phenylmethoxypiperidin-1-yl)butan-1-ol.
| Compound Name | N-(4-fluorophenyl)formamide;4-(4-phenylmethoxypiperidin-1-yl)butan-1-ol |
|---|---|
| PubChem CID | 142235239 |
| Molecular Formula | C23H31FN2O3 |
| Molecular Weight | 402.51 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | N-(4-fluorophenyl)formamide;4-(4-phenylmethoxypiperidin-1-yl)butan-1-ol |
| SMILES | O=CNc1ccc(F)cc1.OCCCCN1CCC(OCc2ccccc2)CC1 |
| InChI | InChI=1S/C16H25NO2.C7H6FNO/c18-13-5-4-10-17-11-8-16(9-12-17)19-14-15-6-2-1-3-7-15;8-6-1-3-7(4-2-6)9-5-10/h1-3,6-7,16,18H,4-5,8-14H2;1-5H,(H,9,10) |
| InChIKey | YFEAIXRFHDBGGM-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.51 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|