C23H28FNO3 — CID 68881467
3-fluoro-2-[4-(4-phenylmethoxypiperidin-1-yl)butyl]benzoic acid (PubChem CID 68881467) has the molecular formula C23H28FNO3 and a molecular weight of 385.48 g/mol. Its IUPAC name is 3-fluoro-2-[4-(4-phenylmethoxypiperidin-1-yl)butyl]benzoic acid.
| Compound Name | 3-fluoro-2-[4-(4-phenylmethoxypiperidin-1-yl)butyl]benzoic acid |
|---|---|
| PubChem CID | 68881467 |
| Molecular Formula | C23H28FNO3 |
| Molecular Weight | 385.48 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | 3-fluoro-2-[4-(4-phenylmethoxypiperidin-1-yl)butyl]benzoic acid |
| SMILES | O=C(O)c1cccc(F)c1CCCCN1CCC(OCc2ccccc2)CC1 |
| InChI | InChI=1S/C23H28FNO3/c24-22-11-6-10-21(23(26)27)20(22)9-4-5-14-25-15-12-19(13-16-25)28-17-18-7-2-1-3-8-18/h1-3,6-8,10-11,19H,4-5,9,12-17H2,(H,26,27) |
| InChIKey | JLMHJGOSFBKORY-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.48 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|