C14H28N2O — CID 142235981
N-methyl-N-[2,4,4-trimethyl-6-(methylamino)hexyl]prop-2-enamide (PubChem CID 142235981) has the molecular formula C14H28N2O and a molecular weight of 240.39 g/mol. Its IUPAC name is N-methyl-N-[2,4,4-trimethyl-6-(methylamino)hexyl]prop-2-enamide.
| Compound Name | N-methyl-N-[2,4,4-trimethyl-6-(methylamino)hexyl]prop-2-enamide |
|---|---|
| PubChem CID | 142235981 |
| Molecular Formula | C14H28N2O |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.22 |
| IUPAC Name | N-methyl-N-[2,4,4-trimethyl-6-(methylamino)hexyl]prop-2-enamide |
| SMILES | C=CC(=O)N(C)CC(C)CC(C)(C)CCNC |
| InChI | InChI=1S/C14H28N2O/c1-7-13(17)16(6)11-12(2)10-14(3,4)8-9-15-5/h7,12,15H,1,8-11H2,2-6H3 |
| InChIKey | IGMLQDBQKIUMAV-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|