C13H15N4O2P — CID 142236402
5-amino-1-methyl-6-oxo-N-[(4-phosphanylphenyl)methyl]pyrimidine-4-carboxamide (PubChem CID 142236402) has the molecular formula C13H15N4O2P and a molecular weight of 290.26 g/mol. Its IUPAC name is 5-amino-1-methyl-6-oxo-N-[(4-phosphanylphenyl)methyl]pyrimidine-4-carboxamide.
| Compound Name | 5-amino-1-methyl-6-oxo-N-[(4-phosphanylphenyl)methyl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 142236402 |
| Molecular Formula | C13H15N4O2P |
| Molecular Weight | 290.26 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 5-amino-1-methyl-6-oxo-N-[(4-phosphanylphenyl)methyl]pyrimidine-4-carboxamide |
| SMILES | Cn1cnc(C(=O)NCc2ccc(P)cc2)c(N)c1=O |
| InChI | InChI=1S/C13H15N4O2P/c1-17-7-16-11(10(14)13(17)19)12(18)15-6-8-2-4-9(20)5-3-8/h2-5,7H,6,14,20H2,1H3,(H,15,18) |
| InChIKey | WSALBVIYRVRUIB-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.26 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|