C13H16N2O — CID 142236952
5-methyl-1-[N-methyl-C-[(1Z)-2-methylbuta-1,3-dienyl]carbonimidoyl]pyridin-2-one (PubChem CID 142236952) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is 5-methyl-1-[N-methyl-C-[(1Z)-2-methylbuta-1,3-dienyl]carbonimidoyl]pyridin-2-one.
| Compound Name | 5-methyl-1-[N-methyl-C-[(1Z)-2-methylbuta-1,3-dienyl]carbonimidoyl]pyridin-2-one |
|---|---|
| PubChem CID | 142236952 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 5-methyl-1-[N-methyl-C-[(1Z)-2-methylbuta-1,3-dienyl]carbonimidoyl]pyridin-2-one |
| SMILES | C=C/C(C)=C\C(=N/C)n1cc(C)ccc1=O |
| InChI | InChI=1S/C13H16N2O/c1-5-10(2)8-12(14-4)15-9-11(3)6-7-13(15)16/h5-9H,1H2,2-4H3/b10-8-,14-12+ |
| InChIKey | ISZBGWVNYDCPLU-FUPPWZCUSA-N |
| XLogP | 2.17 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|