C19H35NO3 — CID 142237895
tert-butyl 3-(hydroxymethyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-4-carboxylate;ethane (PubChem CID 142237895) has the molecular formula C19H35NO3 and a molecular weight of 325.49 g/mol. Its IUPAC name is tert-butyl 3-(hydroxymethyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-4-carboxylate;ethane.
| Compound Name | tert-butyl 3-(hydroxymethyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-4-carboxylate;ethane |
|---|---|
| PubChem CID | 142237895 |
| Molecular Formula | C19H35NO3 |
| Molecular Weight | 325.49 g/mol |
| Exact Mass | 325.26 |
| IUPAC Name | tert-butyl 3-(hydroxymethyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-4-carboxylate;ethane |
| SMILES | CC.CC.CC(C)(C)OC(=O)N1CC2C3C=CC(C3)C2C1CO |
| InChI | InChI=1S/C15H23NO3.2C2H6/c1-15(2,3)19-14(18)16-7-11-9-4-5-10(6-9)13(11)12(16)8-17;2*1-2/h4-5,9-13,17H,6-8H2,1-3H3;2*1-2H3 |
| InChIKey | UHOHTBGZFPVZDP-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.49 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|