C13H24O2S — CID 142239294
tert-butyl 3-[(Z)-but-2-enyl]sulfanyl-3-methylbutanoate (PubChem CID 142239294) has the molecular formula C13H24O2S and a molecular weight of 244.40 g/mol. Its IUPAC name is tert-butyl 3-[(Z)-but-2-enyl]sulfanyl-3-methylbutanoate.
| Compound Name | tert-butyl 3-[(Z)-but-2-enyl]sulfanyl-3-methylbutanoate |
|---|---|
| PubChem CID | 142239294 |
| Molecular Formula | C13H24O2S |
| Molecular Weight | 244.40 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | tert-butyl 3-[(Z)-but-2-enyl]sulfanyl-3-methylbutanoate |
| SMILES | C/C=C\CSC(C)(C)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H24O2S/c1-7-8-9-16-13(5,6)10-11(14)15-12(2,3)4/h7-8H,9-10H2,1-6H3/b8-7- |
| InChIKey | HBWRLKKZUPDMDQ-FPLPWBNLSA-N |
| XLogP | 3.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.40 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|