About cyclopentyl N-ethylidenecarbamate;methane;morpholine
cyclopentyl N-ethylidenecarbamate;methane;morpholine (PubChem CID 142239577) has the molecular formula C13H26N2O3
and a molecular weight of 258.36 g/mol. Its IUPAC name is cyclopentyl N-ethylidenecarbamate;methane;morpholine.
Molecular Properties
| Compound Name | cyclopentyl N-ethylidenecarbamate;methane;morpholine |
| PubChem CID | 142239577 |
| Molecular Formula | C13H26N2O3 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.19 |
| IUPAC Name | cyclopentyl N-ethylidenecarbamate;methane;morpholine |
| SMILES | C.C1COCCN1.CC=NC(=O)OC1CCCC1 |
| InChI | InChI=1S/C8H13NO2.C4H9NO.CH4/c1-2-9-8(10)11-7-5-3-4-6-7;1-3-6-4-2-5-1;/h2,7H,3-6H2,1H3;5H,1-4H2;1H4 |
| InChIKey | QJOZZTGXVIJIAQ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze cyclopentyl N-ethylidenecarbamate;methane;morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentyl N-ethylidenecarbamate;methane;morpholine?
The IUPAC name of cyclopentyl N-ethylidenecarbamate;methane;morpholine (CID 142239577) is cyclopentyl N-ethylidenecarbamate;methane;morpholine.
What is the SMILES notation for cyclopentyl N-ethylidenecarbamate;methane;morpholine?
The canonical SMILES for cyclopentyl N-ethylidenecarbamate;methane;morpholine is C.C1COCCN1.CC=NC(=O)OC1CCCC1.
What is the InChIKey of cyclopentyl N-ethylidenecarbamate;methane;morpholine?
The InChIKey is QJOZZTGXVIJIAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO2.C4H9NO.CH4/c1-2-9-8(10)11-7-5-3-4-6-7;1-3-6-4-2-5-1;/h2,7H,3-6H2,1H3;5H,1-4H2;1H4.
What are the key properties of cyclopentyl N-ethylidenecarbamate;methane;morpholine?
cyclopentyl N-ethylidenecarbamate;methane;morpholine has a molecular weight of 258.36 g/mol, XLogP of 2.40, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentyl N-ethylidenecarbamate;methane;morpholine is sourced from PubChem (CID 142239577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).