About (1-ethylpiperidin-4-yl) N-ethylidenecarbamate;methane;morpholine
(1-ethylpiperidin-4-yl) N-ethylidenecarbamate;methane;morpholine (PubChem CID 142227573) has the molecular formula C15H31N3O3
and a molecular weight of 301.43 g/mol. Its IUPAC name is (1-ethylpiperidin-4-yl) N-ethylidenecarbamate;methane;morpholine.
Molecular Properties
| Compound Name | (1-ethylpiperidin-4-yl) N-ethylidenecarbamate;methane;morpholine |
| PubChem CID | 142227573 |
| Molecular Formula | C15H31N3O3 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.24 |
| IUPAC Name | (1-ethylpiperidin-4-yl) N-ethylidenecarbamate;methane;morpholine |
| SMILES | C.C1COCCN1.CC=NC(=O)OC1CCN(CC)CC1 |
| InChI | InChI=1S/C10H18N2O2.C4H9NO.CH4/c1-3-11-10(13)14-9-5-7-12(4-2)8-6-9;1-3-6-4-2-5-1;/h3,9H,4-8H2,1-2H3;5H,1-4H2;1H4 |
| InChIKey | GBHDDKCDNMDJSE-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (1-ethylpiperidin-4-yl) N-ethylidenecarbamate;methane;morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-ethylpiperidin-4-yl) N-ethylidenecarbamate;methane;morpholine?
The IUPAC name of (1-ethylpiperidin-4-yl) N-ethylidenecarbamate;methane;morpholine (CID 142227573) is (1-ethylpiperidin-4-yl) N-ethylidenecarbamate;methane;morpholine.
What is the SMILES notation for (1-ethylpiperidin-4-yl) N-ethylidenecarbamate;methane;morpholine?
The canonical SMILES for (1-ethylpiperidin-4-yl) N-ethylidenecarbamate;methane;morpholine is C.C1COCCN1.CC=NC(=O)OC1CCN(CC)CC1.
What is the InChIKey of (1-ethylpiperidin-4-yl) N-ethylidenecarbamate;methane;morpholine?
The InChIKey is GBHDDKCDNMDJSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O2.C4H9NO.CH4/c1-3-11-10(13)14-9-5-7-12(4-2)8-6-9;1-3-6-4-2-5-1;/h3,9H,4-8H2,1-2H3;5H,1-4H2;1H4.
What are the key properties of (1-ethylpiperidin-4-yl) N-ethylidenecarbamate;methane;morpholine?
(1-ethylpiperidin-4-yl) N-ethylidenecarbamate;methane;morpholine has a molecular weight of 301.43 g/mol, XLogP of 1.94, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-ethylpiperidin-4-yl) N-ethylidenecarbamate;methane;morpholine is sourced from PubChem (CID 142227573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).