C11H21NO2 — CID 97355933
[(3R)-1-ethylpyrrolidin-3-yl] 2,2-dimethylpropanoate (PubChem CID 97355933) has the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. Its IUPAC name is [(3R)-1-ethylpyrrolidin-3-yl] 2,2-dimethylpropanoate.
| Compound Name | [(3R)-1-ethylpyrrolidin-3-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 97355933 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | [(3R)-1-ethylpyrrolidin-3-yl] 2,2-dimethylpropanoate |
| SMILES | CCN1CC[C@@H](OC(=O)C(C)(C)C)C1 |
| InChI | InChI=1S/C11H21NO2/c1-5-12-7-6-9(8-12)14-10(13)11(2,3)4/h9H,5-8H2,1-4H3/t9-/m1/s1 |
| InChIKey | NLPNAGJBNHWKQL-SECBINFHSA-N |
| XLogP | 1.67 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |