C21H19FN4O2S — CID 142239755
3-(3-fluoro-5-piperazin-1-ylsulfinyl-1H-indol-2-yl)-1H-quinolin-2-one (PubChem CID 142239755) has the molecular formula C21H19FN4O2S and a molecular weight of 410.47 g/mol. Its IUPAC name is 3-(3-fluoro-5-piperazin-1-ylsulfinyl-1H-indol-2-yl)-1H-quinolin-2-one.
| Compound Name | 3-(3-fluoro-5-piperazin-1-ylsulfinyl-1H-indol-2-yl)-1H-quinolin-2-one |
|---|---|
| PubChem CID | 142239755 |
| Molecular Formula | C21H19FN4O2S |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | 3-(3-fluoro-5-piperazin-1-ylsulfinyl-1H-indol-2-yl)-1H-quinolin-2-one |
| SMILES | O=c1[nH]c2ccccc2cc1-c1[nH]c2ccc(S(=O)N3CCNCC3)cc2c1F |
| InChI | InChI=1S/C21H19FN4O2S/c22-19-15-12-14(29(28)26-9-7-23-8-10-26)5-6-18(15)24-20(19)16-11-13-3-1-2-4-17(13)25-21(16)27/h1-6,11-12,23-24H,7-10H2,(H,25,27) |
| InChIKey | FOCRMLSAFMURIF-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 80.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |