C22H22N2OS — CID 168940731
2-[5-(azetidin-1-ylsulfinyl)-2-(cyclopenten-1-yl)phenyl]-1H-indole (PubChem CID 168940731) has the molecular formula C22H22N2OS and a molecular weight of 362.50 g/mol. Its IUPAC name is 2-[5-(azetidin-1-ylsulfinyl)-2-(cyclopenten-1-yl)phenyl]-1H-indole.
| Compound Name | 2-[5-(azetidin-1-ylsulfinyl)-2-(cyclopenten-1-yl)phenyl]-1H-indole |
|---|---|
| PubChem CID | 168940731 |
| Molecular Formula | C22H22N2OS |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 2-[5-(azetidin-1-ylsulfinyl)-2-(cyclopenten-1-yl)phenyl]-1H-indole |
| SMILES | O=S(c1ccc(C2=CCCC2)c(-c2cc3ccccc3[nH]2)c1)N1CCC1 |
| InChI | InChI=1S/C22H22N2OS/c25-26(24-12-5-13-24)18-10-11-19(16-6-1-2-7-16)20(15-18)22-14-17-8-3-4-9-21(17)23-22/h3-4,6,8-11,14-15,23H,1-2,5,7,12-13H2 |
| InChIKey | QLNFNQVJZHXYRG-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |