C22H25N3S — CID 168940531
2-(2-pyrrolidin-1-yl-5-pyrrolidin-1-ylsulfanylphenyl)-1H-indole (PubChem CID 168940531) has the molecular formula C22H25N3S and a molecular weight of 363.53 g/mol. Its IUPAC name is 2-(2-pyrrolidin-1-yl-5-pyrrolidin-1-ylsulfanylphenyl)-1H-indole.
| Compound Name | 2-(2-pyrrolidin-1-yl-5-pyrrolidin-1-ylsulfanylphenyl)-1H-indole |
|---|---|
| PubChem CID | 168940531 |
| Molecular Formula | C22H25N3S |
| Molecular Weight | 363.53 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 2-(2-pyrrolidin-1-yl-5-pyrrolidin-1-ylsulfanylphenyl)-1H-indole |
| SMILES | c1ccc2[nH]c(-c3cc(SN4CCCC4)ccc3N3CCCC3)cc2c1 |
| InChI | InChI=1S/C22H25N3S/c1-2-8-20-17(7-1)15-21(23-20)19-16-18(26-25-13-5-6-14-25)9-10-22(19)24-11-3-4-12-24/h1-2,7-10,15-16,23H,3-6,11-14H2 |
| InChIKey | SQDARUWLMOAXLL-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 22.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.53 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|