C20H20F2N2OS — CID 176573778
2-[2-[3-(difluoromethoxy)azetidin-1-yl]-5-ethylsulfanylphenyl]-1H-indole (PubChem CID 176573778) has the molecular formula C20H20F2N2OS and a molecular weight of 374.46 g/mol. Its IUPAC name is 2-[2-[3-(difluoromethoxy)azetidin-1-yl]-5-ethylsulfanylphenyl]-1H-indole.
| Compound Name | 2-[2-[3-(difluoromethoxy)azetidin-1-yl]-5-ethylsulfanylphenyl]-1H-indole |
|---|---|
| PubChem CID | 176573778 |
| Molecular Formula | C20H20F2N2OS |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 2-[2-[3-(difluoromethoxy)azetidin-1-yl]-5-ethylsulfanylphenyl]-1H-indole |
| SMILES | CCSc1ccc(N2CC(OC(F)F)C2)c(-c2cc3ccccc3[nH]2)c1 |
| InChI | InChI=1S/C20H20F2N2OS/c1-2-26-15-7-8-19(24-11-14(12-24)25-20(21)22)16(10-15)18-9-13-5-3-4-6-17(13)23-18/h3-10,14,20,23H,2,11-12H2,1H3 |
| InChIKey | ISAKLUIQOFIESN-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |