C22H24N3O2S- — CID 176573455
CID 176573455 (PubChem CID 176573455) has the molecular formula C22H24N3O2S- and a molecular weight of 394.52 g/mol.
| Compound Name | CID 176573455 |
|---|---|
| PubChem CID | 176573455 |
| Molecular Formula | C22H24N3O2S- |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | — |
| SMILES | [H]/N=[S-](=O)/[C@H](C)c1ccc(N2CC[C@H](C(C)=O)C2)c(-c2cc3ccccc3[nH]2)c1 |
| InChI | InChI=1S/C22H24N3O2S/c1-14(26)18-9-10-25(13-18)22-8-7-16(15(2)28(23)27)11-19(22)21-12-17-5-3-4-6-20(17)24-21/h3-8,11-12,15,18,23-24H,9-10,13H2,1-2H3/q-1/t15-,18+/m1/s1 |
| InChIKey | FYIUUKBCOHAOLQ-QAPCUYQASA-N |
| XLogP | 5.04 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|