C22H21F2N6OS- — CID 176573619
CID 176573619 (PubChem CID 176573619) has the molecular formula C22H21F2N6OS- and a molecular weight of 455.51 g/mol.
| Compound Name | CID 176573619 |
|---|---|
| PubChem CID | 176573619 |
| Molecular Formula | C22H21F2N6OS- |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | — |
| SMILES | [H]/N=[S-](=O)/[C@H](C)c1ccc(N2CCC(F)(F)C2)c(-c2cc3cc(-c4cn[nH]n4)ccc3[nH]2)c1 |
| InChI | InChI=1S/C22H21F2N6OS/c1-13(32(25)31)14-3-5-21(30-7-6-22(23,24)12-30)17(9-14)19-10-16-8-15(2-4-18(16)27-19)20-11-26-29-28-20/h2-5,8-11,13,25,27H,6-7,12H2,1H3,(H,26,28,29)/q-1/t13-/m1/s1 |
| InChIKey | JMVUJYGVTRJHNK-CYBMUJFWSA-N |
| XLogP | 5.25 |
| TPSA | 101.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|