C8H11N3O4 — CID 142239879
2-[(3-ethyl-2,4-dioxo-1H-pyrimidin-5-yl)amino]acetic acid (PubChem CID 142239879) has the molecular formula C8H11N3O4 and a molecular weight of 213.19 g/mol. Its IUPAC name is 2-[(3-ethyl-2,4-dioxo-1H-pyrimidin-5-yl)amino]acetic acid.
| Compound Name | 2-[(3-ethyl-2,4-dioxo-1H-pyrimidin-5-yl)amino]acetic acid |
|---|---|
| PubChem CID | 142239879 |
| Molecular Formula | C8H11N3O4 |
| Molecular Weight | 213.19 g/mol |
| Exact Mass | 213.07 |
| IUPAC Name | 2-[(3-ethyl-2,4-dioxo-1H-pyrimidin-5-yl)amino]acetic acid |
| SMILES | CCn1c(=O)[nH]cc(NCC(=O)O)c1=O |
| InChI | InChI=1S/C8H11N3O4/c1-2-11-7(14)5(3-10-8(11)15)9-4-6(12)13/h3,9H,2,4H2,1H3,(H,10,15)(H,12,13) |
| InChIKey | ZQBREVUZPGNDEN-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 104.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.19 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |