C31H38N2O — CID 142240180
(2S,3S)-2-[benzyl(ethyl)amino]-1-(4-benzylpiperidin-1-yl)-3-phenylbutan-1-one (PubChem CID 142240180) has the molecular formula C31H38N2O and a molecular weight of 454.66 g/mol. Its IUPAC name is (2S,3S)-2-[benzyl(ethyl)amino]-1-(4-benzylpiperidin-1-yl)-3-phenylbutan-1-one.
| Compound Name | (2S,3S)-2-[benzyl(ethyl)amino]-1-(4-benzylpiperidin-1-yl)-3-phenylbutan-1-one |
|---|---|
| PubChem CID | 142240180 |
| Molecular Formula | C31H38N2O |
| Molecular Weight | 454.66 g/mol |
| Exact Mass | 454.30 |
| IUPAC Name | (2S,3S)-2-[benzyl(ethyl)amino]-1-(4-benzylpiperidin-1-yl)-3-phenylbutan-1-one |
| SMILES | CCN(Cc1ccccc1)[C@H](C(=O)N1CCC(Cc2ccccc2)CC1)[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C31H38N2O/c1-3-32(24-28-15-9-5-10-16-28)30(25(2)29-17-11-6-12-18-29)31(34)33-21-19-27(20-22-33)23-26-13-7-4-8-14-26/h4-18,25,27,30H,3,19-24H2,1-2H3/t25-,30-/m0/s1 |
| InChIKey | SQBFIVINGYRMQQ-QCDSWUKFSA-N |
| XLogP | 6.16 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.66 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |